5'-O-DMT-PAC-dA structure
|
Common Name | 5'-O-DMT-PAC-dA | ||
|---|---|---|---|---|
| CAS Number | 110522-82-2 | Molecular Weight | 687.74000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H37N5O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5'-O-DMT-PAC-dA5'-O-DMT-PAC-dA can be used in the synthesis of oligoribonucleotides[1]. |
| Name | 2'-Deoxy-5'-O-DMT-N6-phenoxyacetyl-D-adenosine |
|---|---|
| Synonym | More Synonyms |
| Description | 5'-O-DMT-PAC-dA can be used in the synthesis of oligoribonucleotides[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C39H37N5O7 |
|---|---|
| Molecular Weight | 687.74000 |
| Exact Mass | 687.26900 |
| PSA | 139.08000 |
| LogP | 5.59110 |
| InChIKey | JDJUQANHKJNEFT-VUHKNJSWSA-N |
| SMILES | COc1ccc(C(OCC2OC(n3cnc4c(NC(=O)COc5ccccc5)ncnc43)CC2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| D'-Methoxy-diglykolaldehyd |
| DMT phenoxyacyldeoxyadenosine |
| Methoxy(2-oxoethoxy)acetaldehyde |
| Acetaldehyde,methoxy(2-oxoethoxy) |
| 5'-O-DMT-PAC-dA |