tert-butyl 2-[(4-chlorophenyl)methyl]-3,3-dimethylbutanoate structure
|
Common Name | tert-butyl 2-[(4-chlorophenyl)methyl]-3,3-dimethylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 110577-60-1 | Molecular Weight | 296.83200 | |
| Density | 1.035g/cm3 | Boiling Point | 351.1ºC at 760 mmHg | |
| Molecular Formula | C17H25ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164ºC | |
| Name | tert-butyl 2-[(4-chlorophenyl)methyl]-3,3-dimethylbutanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.035g/cm3 |
|---|---|
| Boiling Point | 351.1ºC at 760 mmHg |
| Molecular Formula | C17H25ClO2 |
| Molecular Weight | 296.83200 |
| Flash Point | 164ºC |
| Exact Mass | 296.15400 |
| PSA | 26.30000 |
| LogP | 4.88650 |
| Vapour Pressure | 4.2E-05mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | XFDNBNAUFGOQMT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C(Cc1ccc(Cl)cc1)C(C)(C)C |
|
~%
tert-butyl 2-[(... CAS#:110577-60-1 |
| Literature: Manabe, Akio; Kirino, Osamu; Furuzawa, Kunihiko; Takano, Hirotaka; Hisada, Yoshio; Tanaka, Shizuya Agricultural and Biological Chemistry, 1987 , vol. 51, # 7 p. 1959 - 1966 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| tert-butyl 2-(4-chlorobenzyl)-3,3-dimethylbutanoate |
| Benzenepropanoic acid,4-chloro-a-(1,1-dimethylethyl)-,1,1-dimethylethyl ester |