2-[(4-chlorophenyl)methyl]-3,3-dimethylbutanoyl chloride structure
|
Common Name | 2-[(4-chlorophenyl)methyl]-3,3-dimethylbutanoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 110577-61-2 | Molecular Weight | 259.17200 | |
| Density | 1.148g/cm3 | Boiling Point | 323.8ºC at 760mmHg | |
| Molecular Formula | C13H16Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.3ºC | |
| Name | 2-[(4-chlorophenyl)methyl]-3,3-dimethylbutanoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 323.8ºC at 760mmHg |
| Molecular Formula | C13H16Cl2O |
| Molecular Weight | 259.17200 |
| Flash Point | 129.3ºC |
| Exact Mass | 258.05800 |
| PSA | 17.07000 |
| LogP | 4.31020 |
| Vapour Pressure | 0.000255mmHg at 25°C |
| Index of Refraction | 1.52 |
| InChIKey | XGODFUMQYAHJDE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(Cc1ccc(Cl)cc1)C(=O)Cl |
|
~%
2-[(4-chlorophe... CAS#:110577-61-2 |
| Literature: Manabe, Akio; Kirino, Osamu; Furuzawa, Kunihiko; Takano, Hirotaka; Hisada, Yoshio; Tanaka, Shizuya Agricultural and Biological Chemistry, 1987 , vol. 51, # 7 p. 1959 - 1966 |
|
~%
2-[(4-chlorophe... CAS#:110577-61-2 |
| Literature: Manabe, Akio; Kirino, Osamu; Furuzawa, Kunihiko; Takano, Hirotaka; Hisada, Yoshio; Tanaka, Shizuya Agricultural and Biological Chemistry, 1987 , vol. 51, # 7 p. 1959 - 1966 |
|
~%
2-[(4-chlorophe... CAS#:110577-61-2 |
| Literature: Manabe, Akio; Kirino, Osamu; Furuzawa, Kunihiko; Takano, Hirotaka; Hisada, Yoshio; Tanaka, Shizuya Agricultural and Biological Chemistry, 1987 , vol. 51, # 7 p. 1959 - 1966 |
|
~%
2-[(4-chlorophe... CAS#:110577-61-2 |
| Literature: Manabe, Akio; Kirino, Osamu; Furuzawa, Kunihiko; Takano, Hirotaka; Hisada, Yoshio; Tanaka, Shizuya Agricultural and Biological Chemistry, 1987 , vol. 51, # 7 p. 1959 - 1966 |
| 2-(4-chlorobenzyl)-3,3-dimethylbutanoyl chloride |
| Benzenepropanoylchloride,4-chloro-a-(1,1-dimethylethyl) |