(2-Bromomethyl)-4-methyl-1-nitrobenzene structure
|
Common Name | (2-Bromomethyl)-4-methyl-1-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 110822-05-4 | Molecular Weight | 230.05900 | |
| Density | 1.565g/cm3 | Boiling Point | 303.97ºC at 760 mmHg | |
| Molecular Formula | C8H8BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 137.637ºC | |
| Name | 2-(bromomethyl)-4-methyl-1-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.565g/cm3 |
|---|---|
| Boiling Point | 303.97ºC at 760 mmHg |
| Molecular Formula | C8H8BrNO2 |
| Molecular Weight | 230.05900 |
| Flash Point | 137.637ºC |
| Exact Mass | 228.97400 |
| PSA | 45.82000 |
| LogP | 3.32130 |
| Vapour Pressure | 0.002mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | LBNASNUBBZAFBL-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c(CBr)c1 |
| HS Code | 2904909090 |
|---|
|
~95%
(2-Bromomethyl)... CAS#:110822-05-4 |
| Literature: UNIVERSITY OF UTAH RESEARCH FOUNDATION; JI, Haitao; YU, Binxun; ZHANG, Min; GUO, Wenxing Patent: WO2013/120045 A1, 2013 ; Location in patent: Paragraph 00273 ; |
|
~%
(2-Bromomethyl)... CAS#:110822-05-4 |
| Literature: UNIVERSITY OF UTAH RESEARCH FOUNDATION; JI, Haitao; YU, Binxun; ZHANG, Min; GUO, Wenxing Patent: WO2013/120045 A1, 2013 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5-Methyl-2-nitrobenzyl Bromide |