2-Nitro-5-methylbenzoic acid structure
|
Common Name | 2-Nitro-5-methylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 3113-72-2 | Molecular Weight | 181.15 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 363.8±30.0 °C at 760 mmHg | |
| Molecular Formula | C8H7NO4 | Melting Point | 134-136 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 165.0±13.0 °C | |
Use of 2-Nitro-5-methylbenzoic acid2-Nitro-5-methylbenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | 5-Methyl-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Nitro-5-methylbenzoic acid is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 363.8±30.0 °C at 760 mmHg |
| Melting Point | 134-136 °C(lit.) |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | 181.15 |
| Flash Point | 165.0±13.0 °C |
| Exact Mass | 181.037506 |
| PSA | 83.12000 |
| LogP | 2.02 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | QRRSIFNWHCKMSW-UHFFFAOYSA-N |
| SMILES | Cc1ccc([N+](=O)[O-])c(C(=O)O)c1 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2916399090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
New preparation of benzo-2, 1, 3-oxadiazoles (benzofurazans). Prokipcak JM and Forte PA.
Can. J. Chem. 48(19) , 3059-3063, (1970)
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 5-Methyl-2-nitro-benzoesaeure |
| 2-Nitro-5-methylbenzoic acid |
| 6-Nitro-m-toluic acid |
| EINECS 221-481-5 |
| 6-Nitro-p-toluic acid |
| Benzoic acid,5-methyl-2-nitro |
| m-Toluic acid,6-nitro |
| WNR D1 BVQ |
| MFCD00007368 |
| 3-Methyl-6-nitrobenzoic acid |
| 5-methyl-2-nitro benzoic acid |
| 5-Methyl-2-nitrobenzoic acid |