(3-Methoxy-5-nitrophenyl)methanamine structure
|
Common Name | (3-Methoxy-5-nitrophenyl)methanamine | ||
|---|---|---|---|---|
| CAS Number | 1108723-88-1 | Molecular Weight | 182.177 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 348.0±27.0 °C at 760 mmHg | |
| Molecular Formula | C8H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 164.2±23.7 °C | |
| Name | (3-methoxy-5-nitrophenyl)methanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 348.0±27.0 °C at 760 mmHg |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.177 |
| Flash Point | 164.2±23.7 °C |
| Exact Mass | 182.069138 |
| PSA | 81.07000 |
| LogP | 1.04 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | TYXYDSDXQMFPCM-UHFFFAOYSA-N |
| SMILES | COc1cc(CN)cc([N+](=O)[O-])c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922199090 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-methoxy-5-nitrobenzylamine |
| 1-(3-Methoxy-5-nitrophenyl)methanamine |
| Benzenemethanamine, 3-methoxy-5-nitro- |