Fmoc-D-Lys(Z)-OH structure
|
Common Name | Fmoc-D-Lys(Z)-OH | ||
|---|---|---|---|---|
| CAS Number | 110990-07-3 | Molecular Weight | 502.55800 | |
| Density | 1.261 g/cm3 | Boiling Point | 751.2ºC at 760 mmHg | |
| Molecular Formula | C29H30N2O6 | Melting Point | 106-110℃ | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-D-Lys(Z)-OHN2-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N6-((benzyloxy)carbonyl)-D-lysine is a lysine derivative[1]. |
| Name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-6-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | N2-(((9H-Fluoren-9-yl)methoxy)carbonyl)-N6-((benzyloxy)carbonyl)-D-lysine is a lysine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.261 g/cm3 |
|---|---|
| Boiling Point | 751.2ºC at 760 mmHg |
| Melting Point | 106-110℃ |
| Molecular Formula | C29H30N2O6 |
| Molecular Weight | 502.55800 |
| Exact Mass | 502.21000 |
| PSA | 113.96000 |
| LogP | 5.85680 |
| Appearance of Characters | Powder | White |
| Vapour Pressure | 1.04E-23mmHg at 25°C |
| Index of Refraction | 1.603 |
| InChIKey | KRULQRVJXQQPQH-AREMUKBSSA-N |
| SMILES | O=C(NCCCCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O)OCc1ccccc1 |
| Storage condition | Store at 0-5°C |
| Hazard Codes | Xi |
|---|
| N-Fmoc-N'-Cbz-D-lysine |
| AmbotzFAA1673 |
| FMOC-D-LYS(Z)-OH |