7-(trifluoromethyl)chroman-4-one structure
|
Common Name | 7-(trifluoromethyl)chroman-4-one | ||
|---|---|---|---|---|
| CAS Number | 111141-02-7 | Molecular Weight | 216.157 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 282.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H7F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.7±22.2 °C | |
| Name | 7-(Trifluoromethyl)chroman-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 282.3±40.0 °C at 760 mmHg |
| Molecular Formula | C10H7F3O2 |
| Molecular Weight | 216.157 |
| Flash Point | 120.7±22.2 °C |
| Exact Mass | 216.039810 |
| PSA | 26.30000 |
| LogP | 3.05 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.486 |
| InChIKey | BDGGJAUEQDZWRC-UHFFFAOYSA-N |
| SMILES | O=C1CCOc2cc(C(F)(F)F)ccc21 |
| Hazard Codes | Xi: Irritant; |
|---|
|
~%
7-(trifluoromet... CAS#:111141-02-7 |
| Literature: US2009/93472 A1, ; Page/Page column 14 ; US 20090093472 A1 |
|
~%
7-(trifluoromet... CAS#:111141-02-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 31, # 1 p. 230 - 243 |
|
~%
7-(trifluoromet... CAS#:111141-02-7 |
| Literature: US2006/128689 A1, ; Page/Page column 24 ; |
|
~%
7-(trifluoromet... CAS#:111141-02-7 |
| Literature: US2008/287428 A1, ; Page/Page column 53-54 ; |
|
~%
7-(trifluoromet... CAS#:111141-02-7 |
| Literature: US2006/128689 A1, ; Page/Page column 12 ; |
|
~%
7-(trifluoromet... CAS#:111141-02-7 |
| Literature: Journal of Medicinal Chemistry, , vol. 31, # 1 p. 230 - 243 |
|
~%
7-(trifluoromet... CAS#:111141-02-7 |
| Literature: US2012/302562 A1, ; US 20120302562 A1 |
| 7-(Trifluoromethyl)-2,3-dihydro-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one, 2,3-dihydro-7-(trifluoromethyl)- |
| 7-(Trifluoromethyl)chroman-4-one |
| 7-(trifluoromethyl)-2,3-dihydrochromen-4-one |