tert-Butyl (trans-4-hydroxycyclohexyl)carbamate structure
|
Common Name | tert-Butyl (trans-4-hydroxycyclohexyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 111300-06-2 | Molecular Weight | 215.289 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 337.7±31.0 °C at 760 mmHg | |
| Molecular Formula | C11H21NO3 | Melting Point | 172-173ºC | |
| MSDS | N/A | Flash Point | 158.0±24.8 °C | |
| Name | Boc-Trans-4-Aminocyclohexanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 337.7±31.0 °C at 760 mmHg |
| Melting Point | 172-173ºC |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.289 |
| Flash Point | 158.0±24.8 °C |
| Exact Mass | 215.152145 |
| PSA | 58.56000 |
| LogP | 1.47 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.485 |
| InChIKey | DQARDWKWPIRJEH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1CCC(O)CC1 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| HS Code | 2924299090 |
|
~99%
tert-Butyl (tra... CAS#:111300-06-2 |
| Literature: Carter, Percy H.; Cherney, Robert J.; Batt, Douglas G.; Brown, Gregory D.; Duncia, John V.; Gardner, Daniel S.; Yang, Michael G. Patent: US2005/54626 A1, 2005 ; Location in patent: Page/Page column 47 ; US 20050054626 A1 |
|
~83%
tert-Butyl (tra... CAS#:111300-06-2 |
| Literature: Almirall, S.A.; Prat Quinones, Maria; Fonquerna Pou, Silvia; Puig Duran, Carlos; Lumeras Amador, Wenceslao; Aiguade Bosch, Jose; Caturla Javaloyes, Juan Francisco Patent: EP2386555 A1, 2011 ; Location in patent: Paragraph 0073 ; |
|
~92%
tert-Butyl (tra... CAS#:111300-06-2 |
| Literature: Raju; Anandan, Sampathkumar; Gu, Shihai; Herradura, Prudencio; O'Dowd, Hardwin; Kim, Bum; Gomez, Marcela; Hackbarth, Corinne; Wu, Charlotte; Wang, Wen; Yuan, Zhengyu; White, Richard; Trias, Joaquim; Patel, Dinesh V. Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 12 p. 3103 - 3107 |
|
~10%
tert-Butyl (tra... CAS#:111300-06-2 |
| Literature: Synthesis, , # 21 p. 3649 - 3653 |
| Precursor 4 | |
|---|---|
| DownStream 8 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbamic acid, N-(cis-4-hydroxycyclohexyl)-, 1,1-dimethylethyl ester |
| trans-4-(tert-ButoxycarbonylaMino)cyclohexanol |
| tert-Butyl (trans-4-hydroxycyclohexyl)carbamate |
| 2-Methyl-2-propanyl (cis-4-hydroxycyclohexyl)carbamate |
| tert-butyl (4-hydroxycyclohexyl)carbamate |
| MFCD03844613 |
| Carbamic acid, N-(4-hydroxycyclohexyl)-, 1,1-dimethylethyl ester |
| tert-Butyl (cis-4-hydroxycyclohexyl)carbamate |
| 2-Methyl-2-propanyl (4-hydroxycyclohexyl)carbamate |
| BOC-TRANS-4-AMINOCYCLOHEXANOL |