Sperabillin A dihydrochloride structure
|
Common Name | Sperabillin A dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 111337-87-2 | Molecular Weight | 398.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H29Cl2N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Sperabillin A dihydrochlorideSperabillin A (dihydrochloride)is new inhibitors ofglutathione S-transferaseisolated from the culture broth ofStreptomyces sp[1]. |
| Name | (3R,5R)-3-amino-N-(3-amino-3-iminopropyl)-6-[[(2E,4Z)-hexa-2,4-dienoyl]amino]-5-hydroxyhexanamide,dihydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Sperabillin A (dihydrochloride)is new inhibitors ofglutathione S-transferaseisolated from the culture broth ofStreptomyces sp[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H29Cl2N5O3 |
|---|---|
| Molecular Weight | 398.32800 |
| Exact Mass | 397.16500 |
| PSA | 161.30000 |
| LogP | 3.93050 |
| InChIKey | OQKJNDABNFAQAJ-JDZFPWRWSA-N |
| SMILES | CC=CC=CC(=O)NCC(O)CC(N)CC(=O)NCCC(=N)N.Cl.Cl |
|
~%
Sperabillin A d... CAS#:111337-87-2 |
| Literature: Hashiguchi; Kawada; Natsugari Synthesis, 1992 , # 4 p. 403 - 408 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Sperabillin C |
| Sperabillin A |
| (3R,5R)-3-amino-N-(3-amino-3-iminopropyl)-6-[[(2E,4Z)-hexa-2,4-dienoyl]amino]-5-hydroxyhexanamide dihydrochloride |
| L-threo-Hexonamide,3-amino-N-(3-amino-3-iminopropyl)-6-((1-oxo-2,4-hexadienyl)amino)-2,3,4,6-tetradeoxy-,(E,Z)-,dihydrochloride |