Octadecanoic acid,9,10-dihydroxy-, methyl ester structure
|
Common Name | Octadecanoic acid,9,10-dihydroxy-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1115-01-1 | Molecular Weight | 330.50300 | |
| Density | 0.968g/cm3 | Boiling Point | 443.1ºC at 760mmHg | |
| Molecular Formula | C19H38O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.2ºC | |
| Name | methyl 9,10-dihydroxyoctadecanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.968g/cm3 |
|---|---|
| Boiling Point | 443.1ºC at 760mmHg |
| Molecular Formula | C19H38O4 |
| Molecular Weight | 330.50300 |
| Flash Point | 143.2ºC |
| Exact Mass | 330.27700 |
| PSA | 66.76000 |
| LogP | 4.36250 |
| Vapour Pressure | 1.03E-09mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | RITHLQKJQSKUAO-UHFFFAOYSA-N |
| SMILES | CCCCCCCCC(O)C(O)CCCCCCCC(=O)OC |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 214-220-1 |
| Octadecanoic acid,9,10-dihydroxy-,methyl ester |
| Methyl 9,10-dihydroxystearate |