IGF-1R inhibitor-2 structure
|
Common Name | IGF-1R inhibitor-2 | ||
|---|---|---|---|---|
| CAS Number | 1116236-15-7 | Molecular Weight | 461.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H24FN7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of IGF-1R inhibitor-2IGF-1R inhibitor-2 (example 121) is an insulin-like growth factor-1 receptor (IGF-1R) inhibitor. Downregulation of IGF-1R can reverse the transformed phenotype of tumor cells and potentially render them susceptible to apoptosis[1]. |
| Name | IGF-1R inhibitor-2 |
|---|
| Description | IGF-1R inhibitor-2 (example 121) is an insulin-like growth factor-1 receptor (IGF-1R) inhibitor. Downregulation of IGF-1R can reverse the transformed phenotype of tumor cells and potentially render them susceptible to apoptosis[1]. |
|---|---|
| Related Catalog | |
| Target |
IGF-1R |
| References |
| Molecular Formula | C24H24FN7O2 |
|---|---|
| Molecular Weight | 461.49 |
| InChIKey | FDCFRUWNFPYFBR-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1Nc1nc(Nc3cccc(F)c3C(N)=O)c3cc[nH]c3n1)CN(C)CC2 |
| Storage condition | -20°C |