1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-5-ethoxypyrrolidin-2-one structure
|
Common Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-5-ethoxypyrrolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 111711-53-6 | Molecular Weight | 405.31300 | |
| Density | 1.54g/cm3 | Boiling Point | 399ºC at 760 mmHg | |
| Molecular Formula | C14H13F6NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.1ºC | |
| Name | 1-[3,5-bis(trifluoromethyl)phenyl]sulfonyl-5-ethoxypyrrolidin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.54g/cm3 |
|---|---|
| Boiling Point | 399ºC at 760 mmHg |
| Molecular Formula | C14H13F6NO4S |
| Molecular Weight | 405.31300 |
| Flash Point | 195.1ºC |
| Exact Mass | 405.04700 |
| PSA | 72.06000 |
| LogP | 4.41660 |
| Vapour Pressure | 1.42E-06mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | RRMCQEBYHAGNLC-UHFFFAOYSA-N |
| SMILES | CCOC1CCC(=O)N1S(=O)(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
|
~%
1-[3,5-bis(trif... CAS#:111711-53-6 |
| Literature: Toja, E; Gorini, C; Zirotti, C; Barzaghi, F; Galliani, G European Journal of Medicinal Chemistry, 1991 , vol. 26, # 4 p. 403 - 413 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-((3,5-Bis(trifluoromethyl)phenyl)sulfonyl)-5-ethoxy-2-pyrrolidinone |
| 2-Pyrrolidinone,1-((3,5-bis(trifluoromethyl)phenyl)sulfonyl)-5-ethoxy |