3,5-Bis(trifluoromethyl)benzene-1-sulfonyl chloride structure
|
Common Name | 3,5-Bis(trifluoromethyl)benzene-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 39234-86-1 | Molecular Weight | 312.617 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 248.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H3ClF6O2S | Melting Point | 34-38 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 104.0±27.3 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | 3,5-bis(trifluoromethyl)benzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 248.3±40.0 °C at 760 mmHg |
| Melting Point | 34-38 °C(lit.) |
| Molecular Formula | C8H3ClF6O2S |
| Molecular Weight | 312.617 |
| Flash Point | 104.0±27.3 °C |
| Exact Mass | 311.944641 |
| PSA | 42.52000 |
| LogP | 4.07 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.435 |
| InChIKey | BTRCVKADYDVSLI-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| Storage condition | Refrigerator |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S36-S36/37/39 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2904909090 |
|
~%
3,5-Bis(trifluo... CAS#:39234-86-1 |
| Literature: Hoffman, Robert V.; Belfoure, Edward L. Journal of the American Chemical Society, 1982 , vol. 104, # 8 p. 2183 - 2189 |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
New library of aminosulfonyl-tagged Hoveyda-Grubbs type complexes: Synthesis, kinetic studies and activity in olefin metathesis transformations.
Beilstein J. Org. Chem. 6 , 1159-66, (2010) Seven novel Hoveyda-Grubbs precatalysts bearing an aminosulfonyl function are reported. Kinetic studies indicate an activity enhancement compared to Hoveyda's precatalyst. A selection of these catalys... |
|
|
Highly enantioselective catalytic thiolysis of prochiral cyclic dicarboxylic anhydrides utilizing a bifunctional chiral sulfonamide.
Angew. Chem. Int. Ed. Engl. 44(36) , 5838-41, (2005)
|
|
|
Versatile chiral reagent for the highly enantioselective synthesis of either anti or syn ester aldols. Corey EJ and Kim SS.
J. Am. Chem. Soc. 112(12) , 4976-4977, (1990)
|
| 3,5-bis(trifluoromethyl)benzene sulfonyl chloride |
| EINECS 254-371-0 |
| 3,5-Bis(trifluoromethyl)benzene-1-sulfonyl chloride |
| MFCD00014725 |
| WSGR CXFFF EXFFF |
| Benzenesulfonyl chloride, 3,5-bis(trifluoromethyl)- |
| 3,5-(bistrifluoromethyl)phenylsulfonyl chloride |
| 3,5-Bis(trifluoromethyl)benzenesulphonyl chloride |
| 3,5-di(trifluoromethyl)benzenesulfonyl chloride |
| 3,5-Di(trifluoromethyl)benzene-1-sulfonyl chloride |
| 3,5-Bis(trifluoromethyl)benzenesulfonyl chloride |