[1-(benzenesulfonyl)-5-oxopyrrolidin-2-yl] acetate structure
|
Common Name | [1-(benzenesulfonyl)-5-oxopyrrolidin-2-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 111711-98-9 | Molecular Weight | 283.30000 | |
| Density | 1.43g/cm3 | Boiling Point | 424.5ºC at 760 mmHg | |
| Molecular Formula | C12H13NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.6ºC | |
| Name | [1-(benzenesulfonyl)-5-oxopyrrolidin-2-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 424.5ºC at 760 mmHg |
| Molecular Formula | C12H13NO5S |
| Molecular Weight | 283.30000 |
| Flash Point | 210.6ºC |
| Exact Mass | 283.05100 |
| PSA | 89.13000 |
| LogP | 1.90560 |
| Vapour Pressure | 2.05E-07mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | WAGXHCZUAWDIGP-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1CCC(=O)N1S(=O)(=O)c1ccccc1 |
|
~%
[1-(benzenesulf... CAS#:111711-98-9 |
| Literature: Toja, E; Gorini, C; Zirotti, C; Barzaghi, F; Galliani, G European Journal of Medicinal Chemistry, 1991 , vol. 26, # 4 p. 403 - 413 |
|
~%
[1-(benzenesulf... CAS#:111711-98-9 |
| Literature: Toja, E; Gorini, C; Zirotti, C; Barzaghi, F; Galliani, G European Journal of Medicinal Chemistry, 1991 , vol. 26, # 4 p. 403 - 413 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-Acetoxy-1-phenylsulfonyl-2-pyrrolidinone |
| 2-Pyrrolidinone,5-(acetyloxy)-1-(phenylsulfonyl) |