(1-cyclohexyl-2-phenylselanylethyl)cyanamide structure
|
Common Name | (1-cyclohexyl-2-phenylselanylethyl)cyanamide | ||
|---|---|---|---|---|
| CAS Number | 111735-16-1 | Molecular Weight | 307.29300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20N2Se | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-cyclohexyl-2-phenylselanylethyl)cyanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H20N2Se |
|---|---|
| Molecular Weight | 307.29300 |
| Exact Mass | 308.07900 |
| PSA | 35.82000 |
| LogP | 2.84488 |
| InChIKey | XIKCCLVPHUEQCH-UHFFFAOYSA-N |
| SMILES | N#CNC(C[Se]c1ccccc1)C1CCCCC1 |
|
~40%
(1-cyclohexyl-2... CAS#:111735-16-1
Detail
|
| Literature: Hernandez, Rosendo; Leon, Elisa I.; Salazar, Jose A.; Suarez, Ernesto Journal of the Chemical Society, Chemical Communications, 1987 , # 4 p. 312 - 314 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| [1-cyclohexyl-2-(phenylseleno)ethyl]cyanamide |
| Cyanamide,[1-cyclohexyl-2-(phenylseleno)ethyl] |