2-methyl-N-[phenyl-(propan-2-ylamino)phosphoryl]propan-2-amine structure
|
Common Name | 2-methyl-N-[phenyl-(propan-2-ylamino)phosphoryl]propan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 111783-67-6 | Molecular Weight | 254.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H23N2OP | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-N-[phenyl-(propan-2-ylamino)phosphoryl]propan-2-amine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H23N2OP |
|---|---|
| Molecular Weight | 254.30800 |
| Exact Mass | 254.15500 |
| PSA | 50.94000 |
| LogP | 3.67290 |
| InChIKey | VDNPYPDOSZMGJN-UHFFFAOYSA-N |
| SMILES | CC(C)NP(=O)(NC(C)(C)C)c1ccccc1 |
|
~%
2-methyl-N-[phe... CAS#:111783-67-6 |
| Literature: Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), , p. 1399 - 1406 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-isopropyl-P-phenyl-N'-t-butylphosphonic diamide |
| Phosphonic diamide,N-(1,1-dimethylethyl)-N'-(1-methylethyl)-P-phenyl |