3-(dimethylamino)-2,2-dimethylpropyl methacrylate structure
|
Common Name | 3-(dimethylamino)-2,2-dimethylpropyl methacrylate | ||
|---|---|---|---|---|
| CAS Number | 1118-38-3 | Molecular Weight | 199.29000 | |
| Density | 0.929g/cm3 | Boiling Point | 254ºC at 760mmHg | |
| Molecular Formula | C11H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 82.9ºC | |
| Name | [3-(dimethylamino)-2,2-dimethylpropyl] 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.929g/cm3 |
|---|---|
| Boiling Point | 254ºC at 760mmHg |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29000 |
| Flash Point | 82.9ºC |
| Exact Mass | 199.15700 |
| PSA | 29.54000 |
| LogP | 1.69350 |
| Vapour Pressure | 0.0177mmHg at 25°C |
| Index of Refraction | 1.457 |
| InChIKey | VVOKYOKVMKJIMT-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCC(C)(C)CN(C)C |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-methyl-propenoic acid 2,2-dimethyl-3-dimethylamino-propyl ester |
| 2,2-Dimethyl-3-dimethylaminopropyl-methacrylat |
| 2-Propenoic acid,2-methyl-,3-(dimethylamino)-2,2-dimethylpropyl ester |
| Methacrylicacid,3-(dimethylamino)-2,2-dimethylpropyl ester (7CI,8CI) |
| EINECS 214-261-5 |