5-((4-(DIMETHYLAMINO)PHENYL)IMINO)-8(5H& structure
|
Common Name | 5-((4-(DIMETHYLAMINO)PHENYL)IMINO)-8(5H& | ||
|---|---|---|---|---|
| CAS Number | 111811-34-8 | Molecular Weight | 277.32100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15N3O | Melting Point | 147-148ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[4-(dimethylamino)phenyl]iminoquinolin-8-one |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 147-148ºC(lit.) |
|---|---|
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.32100 |
| Exact Mass | 277.12200 |
| PSA | 45.56000 |
| LogP | 3.02090 |
| InChIKey | ACXSDJPEKINDBW-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N=C2C=CC(=O)c3ncccc32)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
|
~73%
5-((4-(DIMETHYL... CAS#:111811-34-8 |
| Literature: Kubo, Yuji; Sasaki, Kyoko; Kataoka, Hisa; Yoshida, Katsuhira Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1989 , p. 1469 - 1472 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 8(5H)-Quinolinone,5-[[4-(dimethylamino)phenyl]imino] |
| 5-(4'-di-methylphenylimino)quinolin-8-one |
| 5-(4-dimethylaminophenyl)iminoquinolin-8-one |