ditert-butyl(cyclobutylmethyl)phosphane structure
|
Common Name | ditert-butyl(cyclobutylmethyl)phosphane | ||
|---|---|---|---|---|
| CAS Number | 111857-32-0 | Molecular Weight | 214.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H27P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ditert-butyl(cyclobutylmethyl)phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H27P |
|---|---|
| Molecular Weight | 214.32700 |
| Exact Mass | 214.18500 |
| PSA | 13.59000 |
| LogP | 4.86540 |
| InChIKey | XXXRLBZTWLBYKW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)P(CC1CCC1)C(C)(C)C |
|
~40%
ditert-butyl(cy... CAS#:111857-32-0 |
| Literature: Simms, Barbara L.; Ibers, James A. Journal of Organometallic Chemistry, 1987 , vol. 327, p. 137 - 146 |
|
~%
ditert-butyl(cy... CAS#:111857-32-0 |
| Literature: Simms, Barbara L.; Ibers, James A. Journal of Organometallic Chemistry, 1987 , vol. 327, p. 137 - 146 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (di-t-butyl)cyclobutylmethylphosphine |
| Phosphine,(cyclobutylmethyl)bis(1,1-dimethylethyl) |