ditert-butyl(methyl)phosphane,platinum structure
|
Common Name | ditert-butyl(methyl)phosphane,platinum | ||
|---|---|---|---|---|
| CAS Number | 64237-17-8 | Molecular Weight | 515.55200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H42P2Pt | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ditert-butyl(methyl)phosphane,platinum |
|---|
| Molecular Formula | C18H42P2Pt |
|---|---|
| Molecular Weight | 515.55200 |
| Exact Mass | 515.24100 |
| PSA | 27.18000 |
| LogP | 7.38770 |
| InChIKey | GWWVIZXUDRXELW-UHFFFAOYSA-N |
| SMILES | CP(C(C)(C)C)C(C)(C)C.CP(C(C)(C)C)C(C)(C)C.[Pt] |
|
~65%
ditert-butyl(me... CAS#:64237-17-8 |
| Literature: Fornies, Juan; Green, Michael; Spencer, John L.; Stone, F. Gordon A. Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1977 , p. 1006 - 1009 |