[S-(E)]-3,7,11-trimethyldodeca-1,6,10-trien-3-ol structure
|
Common Name | [S-(E)]-3,7,11-trimethyldodeca-1,6,10-trien-3-ol | ||
|---|---|---|---|---|
| CAS Number | 1119-38-6 | Molecular Weight | 222.36600 | |
| Density | 0.869g/cm3 | Boiling Point | 276ºC at 760mmHg | |
| Molecular Formula | C15H26O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.9ºC | |
| Name | (3S,6E)-nerolidol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.869g/cm3 |
|---|---|
| Boiling Point | 276ºC at 760mmHg |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.36600 |
| Flash Point | 109.9ºC |
| Exact Mass | 222.19800 |
| PSA | 20.23000 |
| LogP | 4.39630 |
| Vapour Pressure | 0.000616mmHg at 25°C |
| Index of Refraction | 1.479 |
| InChIKey | FQTLCLSUCSAZDY-ATGUSINASA-N |
| SMILES | C=CC(C)(O)CCC=C(C)CCC=C(C)C |
|
~%
[S-(E)]-3,7,11-... CAS#:1119-38-6 |
| Literature: Kigoshi, Hideo; Ojika, Makoto; Shizuri, Yoshikazu; Niwa, Haruki; Yamada, Kiyoyuki Tetrahedron, 1986 , vol. 42, # 14 p. 3789 - 3792 |
|
~90%
[S-(E)]-3,7,11-... CAS#:1119-38-6 |
| Literature: Dittmer, Donald C.; Discordia, Robert P.; Zhang, Yanzhi; Murphy, Christopher K.; Kumar, Archana; et al. Journal of Organic Chemistry, 1993 , vol. 58, # 3 p. 718 - 731 |
| (3S)-(E)-nerolidol |
| ocusertp20 |
| pilokarpol |
| Pilocarpol |
| 3,7,11-Trimethyl-1,6,10-dodecatrien-3-ol |
| (R)-(-)-nerolidol |
| Pilocarpin |
| Syncarpine |
| Pilokarpin |
| 3-ethyl-4-((1-methyl-1H-imidazol-5-yl)methyl)dihydrofuran-2(3H)-one |
| (S)-(+)-trans-nerolidol |
| (+) E(S) nerolidol |
| EINECS 214-276-7 |
| Ocucarpine |
| (3S,4R)-3-ethyl-4,5-dihydro-4-[(1-methyl-1H-imidazol-5-yl)methyl]furan-2(3H)-one |
| Ocusert |
| (+)-pilocarpine |
| (S)-(+)-nerolidol |
| actone |
| (+)-(3S,4R)-pilocarpine |
| (3S)-trans-nerolidol |