N-[2-(dimethylamino)ethyl]-9,10-dioxoanthracene-1-carboxamide structure
|
Common Name | N-[2-(dimethylamino)ethyl]-9,10-dioxoanthracene-1-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 112022-06-7 | Molecular Weight | 322.35800 | |
| Density | 1.258g/cm3 | Boiling Point | 512.4ºC at 760mmHg | |
| Molecular Formula | C19H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 263.7ºC | |
| Name | N-[2-(dimethylamino)ethyl]-9,10-dioxoanthracene-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 512.4ºC at 760mmHg |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.35800 |
| Flash Point | 263.7ºC |
| Exact Mass | 322.13200 |
| PSA | 69.97000 |
| LogP | 2.32820 |
| Vapour Pressure | 1.29E-10mmHg at 25°C |
| Index of Refraction | 1.619 |
| InChIKey | ZAGSATOZMNXKMU-UHFFFAOYSA-N |
| SMILES | CN(C)CCNC(=O)c1cccc2c1C(=O)c1ccccc1C2=O |
|
~%
N-[2-(dimethyla... CAS#:112022-06-7 |
| Literature: Palmer; Rewcastle; Atwell; Baguley; Denny Journal of Medicinal Chemistry, 1988 , vol. 31, # 4 p. 707 - 712 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9,10-Dihydro-N-(2-(dimethylamino)ethyl)-9,10-dioxo-1-anthracenecarboxamide |
| N-(2-(Dimethylamino)ethyl)-9,10-dihydro-9,10-dioxo-1-anthracenecarboxamide |
| 1-Anthracenecarboxamide,9,10-dihydro-N-(2-(dimethylamino)ethyl)-9,10-dioxo |