1-Anthraquinonecarboxylic acid structure
|
Common Name | 1-Anthraquinonecarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 602-69-7 | Molecular Weight | 252.22200 | |
| Density | 1.469g/cm3 | Boiling Point | 513ºC at 760 mmHg | |
| Molecular Formula | C15H8O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 278.2ºC | |
| Name | Anthraquinone-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 513ºC at 760 mmHg |
| Molecular Formula | C15H8O4 |
| Molecular Weight | 252.22200 |
| Flash Point | 278.2ºC |
| Exact Mass | 252.04200 |
| PSA | 71.44000 |
| LogP | 2.16020 |
| Index of Refraction | 1.69 |
| InChIKey | POPBYCBXVLHSKO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc2c1C(=O)c1ccccc1C2=O |
| HS Code | 2918300090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 7 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 9,10-anthraquinone-1-carboxylic acid |
| 1-Anthraquinonecarboxylic acid |
| 9,10-Dioxo-9,10-dihydro-anthracen-1-carbonsaeure |
| 9,10-Dihydro-9,10-dioxo-1-anthracenecarboxylic acid |
| 9,10-dioxo-9,10-dihydro-anthracene-1-carboxylic acid |
| 9,10-dioxo-9,10-dihydro-1-anthracene carboxylic acid |
| anthraquinonecarboxylic acid |