Ethyl 1-phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylate structure
|
Common Name | Ethyl 1-phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 112055-34-2 | Molecular Weight | 284.234 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 355.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H11F3N2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 168.5±27.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | ethyl 2-phenyl-3-(trifluoromethyl)pyrazole-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 355.0±42.0 °C at 760 mmHg |
| Molecular Formula | C13H11F3N2O2 |
| Molecular Weight | 284.234 |
| Flash Point | 168.5±27.9 °C |
| Exact Mass | 284.077271 |
| PSA | 44.12000 |
| LogP | 4.42 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | ZJGRCTISRZQYRY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnn(-c2ccccc2)c1C(F)(F)F |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933199090 |
|
~78%
Ethyl 1-phenyl-... CAS#:112055-34-2 |
| Literature: Beck, James R.; Wright, Fred L. Journal of Heterocyclic Chemistry, 1987 , vol. 24, p. 739 - 740 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Pyrazole-4-carboxylic acid, 1-phenyl-5-(trifluoromethyl)-, ethyl ester |
| MFCD00068138 |
| Ethyl 5-(trifluoromethyl)-1-phenyl-1H-pyrazole-4-carboxylate |
| Ethyl 1-phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylate |
| ethyl 5-trifluoromethyl-1-phenyl-1H-pyrazole-4-carboxylate |