6-[(2-hydroxy-5-nitroanilino)methylidene]-4-nitrocyclohexa-2,4-dien-1-one structure
|
Common Name | 6-[(2-hydroxy-5-nitroanilino)methylidene]-4-nitrocyclohexa-2,4-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 112383-44-5 | Molecular Weight | 303.22700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-[(2-hydroxy-5-nitroanilino)methylidene]-4-nitrocyclohexa-2,4-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9N3O6 |
|---|---|
| Molecular Weight | 303.22700 |
| Exact Mass | 303.04900 |
| PSA | 140.97000 |
| LogP | 3.01510 |
| InChIKey | JPGDTQYFKRXXJL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(O)c(C=Nc2cc([N+](=O)[O-])ccc2O)c1 |
|
~%
6-[(2-hydroxy-5... CAS#:112383-44-5 |
| Literature: Guerkan, Perihan; Guenduez, Necla Journal of the Indian Chemical Society, 1997 , vol. 74, # 9 p. 713 - 714 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(5-nitrosalicylideneamino)-4-nitrophenol |
| Phenol,2-[[(2-hydroxy-5-nitrophenyl)imino]methyl]-4-nitro |
| 2-(5-nitro-salicylidenamino)-4-nitro-phenol |
| 2-[(2-hydroxy-5-nitrobenzylidene)amino]-4-nitrophenol |