5-Nitrosalicylaldehyde structure
|
Common Name | 5-Nitrosalicylaldehyde | ||
|---|---|---|---|---|
| CAS Number | 97-51-8 | Molecular Weight | 167.119 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 300.2±32.0 °C at 760 mmHg | |
| Molecular Formula | C7H5NO4 | Melting Point | 125-128 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 137.3±13.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-Nitrosalicylaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 300.2±32.0 °C at 760 mmHg |
| Melting Point | 125-128 °C(lit.) |
| Molecular Formula | C7H5NO4 |
| Molecular Weight | 167.119 |
| Flash Point | 137.3±13.6 °C |
| Exact Mass | 167.021851 |
| PSA | 83.12000 |
| LogP | 2.08 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | IHFRMUGEILMHNU-UHFFFAOYSA-N |
| SMILES | O=Cc1cc([N+](=O)[O-])ccc1O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22;R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | CU6675000 |
| HS Code | 2913000090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
|
Spiropyran-Decorated SiO₂-Pt Janus Micromotor: Preparation and Light-Induced Dynamic Self-Assembly and Disassembly.
ACS Appl. Mater. Interfaces 7 , 24585-91, (2015) The controlled self-assembly of self-propelled Janus micromotors may give the micromotors some potential applications in many fields. In this work, we design a kind of SiO2-Pt Janus catalytic micromot... |
|
|
Chlorogenic acid and hydroxynitrobenzaldehyde: new inhibitors of hepatic glucose 6-phosphatase.
Arch. Biochem. Biophys. 339(2) , 315-22, (1997) We have studied the interactions of chlorogenic acid (CHL) and 2-hydroxy-5-nitrobenzaldehyde (HNB) with the components of the rat hepatic glucose 6-phosphatase (Glc-6-Pase) system. CHL and HNB are com... |
|
|
Localization of cathepsin B activity in fibroblasts and chondrocytes by continuous monitoring of the formation of a final fluorescent reaction product using 5-nitrosalicylaldehyde.
Histochem. J. 19(9) , 483-7, (1987) The histochemical fluorescence method using 5-nitrosalicylaldehyde for the demonstration of cathepsin B activity has been used. Precipitation of the fluorescent final reaction product was analysed con... |
|
Name: In Vitro Assay from US Patent US9981901: "IRE-1α inhibitors"
Source: BindingDB
Target: N/A
External Id: BindingDB_3284_1
|
|
Name: In Vitro Enzyme Assays from US Patent US8614253: "IRE-1α inhibitors"
Source: BindingDB
Target: N/A
External Id: BindingDB_6134_1
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
|
Name: In Vitro Enzyme Assay from US Patent US9241942: "IRE-1α inhibitors"
Source: BindingDB
Target: N/A
External Id: BindingDB_7561_1
|
| WNR DQ CVH |
| MFCD00007337 |
| 5-Nitrosalicylaldehyde |
| 2-Formyl-4-nitrophenol |
| 2-Hydroxy-5-nitrobenzaldehyde |
| EINECS 202-587-0 |