N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide
Modify Date: 2025-08-31 18:30:33
N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide structure
|
Common Name | N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide | ||
|---|---|---|---|---|
| CAS Number | 112446-69-2 | Molecular Weight | 267.78 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14ClN3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14ClN3S |
|---|---|
| Molecular Weight | 267.78 |
| InChIKey | YROLLLIMYXIZKL-UHFFFAOYSA-N |
| SMILES | CCN(C=Nc1nc2c(Cl)cccc2s1)CC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide? |
| A: CAS number of N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide is 112446-69-2. |
| Q: What is the Chinese name of 112446-69-2? |
| A: Chinese name of 112446-69-2 is 112446-69-2. |
| Q: What is the SMILES notation of N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide? |
| A: SMILES notation of N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide is CCN(C=Nc1nc2c(Cl)cccc2s1)CC. |
| Q: What is the molecular formula of N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide? |
| A: Molecular formula of N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide is C12H14ClN3S. |
| Q: What is the molecular weight of N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide? |
| A: Molecular weight of N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide is 267.78. |
| Q: What is the English name of N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide? |
| A: The English name of N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide is N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide. |
| Q: What is the InChIKey of N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide? |
| A: InChIKey of N'-(4-Chloro-1,3-benzothiazol-2-yl)-N,N-diethylformimidamide is YROLLLIMYXIZKL-UHFFFAOYSA-N. |