ogerin negative control structure
|
Common Name | ogerin negative control | ||
|---|---|---|---|---|
| CAS Number | 1125453-08-8 | Molecular Weight | 307.35 | |
| Density | 1.332±0.06 g/cm3(Predicted) | Boiling Point | 623.8±65.0 °C(Predicted) | |
| Molecular Formula | C17H17N5O | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Name | ogerin negative control |
|---|
| Density | 1.332±0.06 g/cm3(Predicted) |
|---|---|
| Boiling Point | 623.8±65.0 °C(Predicted) |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.35 |
| Appearance of Characters | powder |
| InChIKey | RVKAHYFWSKSSQQ-UHFFFAOYSA-N |
| SMILES | Nc1nc(NCc2ccccc2)nc(-c2cccc(CO)c2)n1 |
| Storage condition | 2-8°C |
| RIDADR | NONH for all modes of transport |
|---|