4-(1H-PYRROL-1-YL)BENZOHYDRAZIDE structure
|
Common Name | 4-(1H-PYRROL-1-YL)BENZOHYDRAZIDE | ||
|---|---|---|---|---|
| CAS Number | 112575-84-5 | Molecular Weight | 201.22500 | |
| Density | 1.24g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H11N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-pyrrol-1-ylbenzohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.22500 |
| Exact Mass | 201.09000 |
| PSA | 60.05000 |
| LogP | 2.17200 |
| Index of Refraction | 1.632 |
| InChIKey | GPXSNEVNUORJCZ-UHFFFAOYSA-N |
| SMILES | NNC(=O)c1ccc(-n2cccc2)cc1 |
| HS Code | 2933990090 |
|---|
|
~78%
4-(1H-PYRROL-1-... CAS#:112575-84-5 |
| Literature: Artico, Marino; Corelli, Federico; Massa, Silvio; Stefancich, Giorgio; Avigliano, Luciana; et al. Journal of Medicinal Chemistry, 1988 , vol. 31, # 4 p. 802 - 806 |
|
~%
4-(1H-PYRROL-1-... CAS#:112575-84-5 |
| Literature: US6265426 B1, ; US 6265426 B1 |
|
~%
4-(1H-PYRROL-1-... CAS#:112575-84-5 |
| Literature: Medicinal Chemistry Research, , vol. 23, # 3 p. 1123 - 1147 |
|
~%
4-(1H-PYRROL-1-... CAS#:112575-84-5 |
| Literature: Medicinal Chemistry Research, , vol. 23, # 3 p. 1123 - 1147 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(pyrrol-1-yl)benzohydrazide |
| 1-pyrrolylbenzene-4-carbohydrazide |
| 4-pyrrol-1-yl benzoic acid hydrazide |
| 4-(1H-pyrrol-1-yl)benzoic acid hydrazide |
| 4-(1H-pyrrol-1-yl)benzohydrazide |