ETHYL 4-(1H-PYRROL-1-YL)BENZOATE structure
|
Common Name | ETHYL 4-(1H-PYRROL-1-YL)BENZOATE | ||
|---|---|---|---|---|
| CAS Number | 5044-37-1 | Molecular Weight | 215.24800 | |
| Density | 1.08g/cm3 | Boiling Point | 122ºC | |
| Molecular Formula | C13H13NO2 | Melting Point | 74ºC | |
| MSDS | N/A | Flash Point | 154.3ºC | |
| Name | ethyl 4-pyrrol-1-ylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 122ºC |
| Melting Point | 74ºC |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.24800 |
| Flash Point | 154.3ºC |
| Exact Mass | 215.09500 |
| PSA | 31.23000 |
| LogP | 2.65400 |
| Index of Refraction | 1.551 |
| InChIKey | FOELSWUYONNGSV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ccc(-n2cccc2)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 4-(1H-pyrrol-1-yl)benzoate |
| 1-(4-ethoxycarbonylphenyl)pyrrole |
| Ethyl4-(1-pyrrolyl)benzoate |
| ethyl 4-pyrrolylbenzoate |
| 4-(pyrrol-1-yl)benzoic acid ethyl ester |
| ethyl 4-(pyrrol-1-yl)benzoate |