1H-Indazole-1,6-dicarboxylic acid, 1-(1,1-dimethylethyl) 6-methyl ester structure
|
Common Name | 1H-Indazole-1,6-dicarboxylic acid, 1-(1,1-dimethylethyl) 6-methyl ester | ||
|---|---|---|---|---|
| CAS Number | 1126424-50-7 | Molecular Weight | 276.288 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 398.8±34.0 °C at 760 mmHg | |
| Molecular Formula | C14H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.0±25.7 °C | |
| Name | 1-tert-Butyl 6-methyl 1H-indazole-1,6-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 398.8±34.0 °C at 760 mmHg |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.288 |
| Flash Point | 195.0±25.7 °C |
| Exact Mass | 276.110992 |
| PSA | 70.42000 |
| LogP | 3.08 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | QWMRWZQWWSEPJS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2cnn(C(=O)OC(C)(C)C)c2c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
|
~95%
1H-Indazole-1,6... CAS#:1126424-50-7 |
| Literature: WO2009/32125 A1, ; Page/Page column 112 ; |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Methyl 6-(2-methyl-2-propanyl) 1H-indazole-1,6-dicarboxylate |
| 1H-Indazole-1,6-dicarboxylic acid, 6-(1,1-dimethylethyl) 1-methyl ester |
| 6-Methyl 1-(2-methyl-2-propanyl) 1H-indazole-1,6-dicarboxylate |
| 1H-Indazole-1,6-dicarboxylic acid, 1-(1,1-dimethylethyl) 6-methyl ester |
| 1-O-tert-butyl 6-O-methyl indazole-1,6-dicarboxylate |