Sunobinop structure
|
Common Name | Sunobinop | ||
|---|---|---|---|---|
| CAS Number | 1126793-40-5 | Molecular Weight | 435.56 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H33N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SunobinopSunobinop (S 117957) is a modulator of the opioid receptor-like orphan receptor (ORL1)[1]. |
| Name | Sunobinop |
|---|
| Description | Sunobinop (S 117957) is a modulator of the opioid receptor-like orphan receptor (ORL1)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C26H33N3O3 |
|---|---|
| Molecular Weight | 435.56 |
| InChIKey | COTYYZPYDJKKIS-MCXOOUIESA-N |
| SMILES | O=C(O)c1nc2ccccc2n(C2CC3CCCC(C2)N3C2CC3CCCC(C3)C2)c1=O |