Impurity F of Calcipotriol structure
|
Common Name | Impurity F of Calcipotriol | ||
|---|---|---|---|---|
| CAS Number | 112875-61-3 | Molecular Weight | 641.12600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H68O3Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Impurity F of CalcipotriolImpurity F of Calcipotriol; Calcipotriol (MC 903; Calcipotriene) is a ligand of VDR-like receptors. IC50 value:Target:Vitamin D3 analog that displays minimal effects on calcium homeostasis. Regulates cell differentiation and proliferation; Calcipotriol (MC 903; Calcipotriene) exhibits antiproliferative activity against human HL-60, HL60/MX2, MCF-7, T47D, SCC-25 and mouse WEHI-3 cancer cell lines. |
| Name | (E,1S,4R)-4-[(1R,3aS,4E,7aR)-4-[(2Z)-2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylidenecyclohexylidene]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1-cyclopropylpent-2-en-1-ol |
|---|---|
| Synonym | More Synonyms |
| Description | Impurity F of Calcipotriol; Calcipotriol (MC 903; Calcipotriene) is a ligand of VDR-like receptors. IC50 value:Target:Vitamin D3 analog that displays minimal effects on calcium homeostasis. Regulates cell differentiation and proliferation; Calcipotriol (MC 903; Calcipotriene) exhibits antiproliferative activity against human HL-60, HL60/MX2, MCF-7, T47D, SCC-25 and mouse WEHI-3 cancer cell lines. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C39H68O3Si2 |
|---|---|
| Molecular Weight | 641.12600 |
| Exact Mass | 640.47100 |
| PSA | 38.69000 |
| LogP | 11.14960 |
| InChIKey | DIMYHZDULFSWLS-UHFFFAOYSA-N |
| SMILES | C=C1C(=CC=C2CCCC3(C)C2CCC3C(C)C=CC(O)C2CC2)CC(O[Si](C)(C)C(C)(C)C)CC1O[Si](C)(C)C(C)(C)C |
| Storage condition | 2-8℃ |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| 1,3-Bis-O-(tert-butyldimethylsilyl)calcipotriene |
| (1S,3R)-bis(tert-butyldimethylsilyloxy)-20(R)-(3'(S)-cyclopropyl-3'-hydroxyprop-1'(E)-enyl)-9,10-secopregna-5(Z),7(E),10(19)-triene |
| 1(S),3(R)-bis(tert-butyl-dimethylsilyloxy)-20(R)-(3'-cyclopropyl-3(S)'-hydroxyprop-1'(E)-enyl)-9,10-secopregna-5(Z),7(E),10(19)-triene |
| UNII-4SP93VP62P |
| Impurity F of Calcipotriol |