2-NITRO-5-PHENOXYTOLUENE structure
|
Common Name | 2-NITRO-5-PHENOXYTOLUENE | ||
|---|---|---|---|---|
| CAS Number | 112880-83-8 | Molecular Weight | 229.23100 | |
| Density | 1.218g/cm3 | Boiling Point | 329ºC at 760mmHg | |
| Molecular Formula | C13H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.4ºC | |
| Name | 2-Methyl-1-nitro-4-phenoxybenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.218g/cm3 |
|---|---|
| Boiling Point | 329ºC at 760mmHg |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.23100 |
| Flash Point | 138.4ºC |
| Exact Mass | 229.07400 |
| PSA | 55.05000 |
| LogP | 4.21870 |
| Vapour Pressure | 0.00035mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | COHVZTXZLIRSTM-UHFFFAOYSA-N |
| SMILES | Cc1cc(Oc2ccccc2)ccc1[N+](=O)[O-] |
| HS Code | 2909309090 |
|---|
|
~10%
2-NITRO-5-PHENO... CAS#:112880-83-8 |
| Literature: US2007/72897 A1, ; Page/Page column 46 ; |
|
~%
2-NITRO-5-PHENO... CAS#:112880-83-8 |
| Literature: US5637593 A1, ; |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 5-phenoxy-2-nitrotoluene |
| 2-Nitro-5-phenoxytoluene |
| p-nitrophenyl-m-tolylether |
| Benzene,2-methyl-1-nitro-4-phenoxy |