2,4-dichloro-6-(trichloromethyl)pyridine structure
|
Common Name | 2,4-dichloro-6-(trichloromethyl)pyridine | ||
|---|---|---|---|---|
| CAS Number | 1129-19-7 | Molecular Weight | 265.35200 | |
| Density | 1.68g/cm3 | Boiling Point | 271.8ºC at 760 mmHg | |
| Molecular Formula | C6H2Cl5N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.3ºC | |
| Name | 2,4-dichloro-6-(trichloromethyl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.68g/cm3 |
|---|---|
| Boiling Point | 271.8ºC at 760 mmHg |
| Molecular Formula | C6H2Cl5N |
| Molecular Weight | 265.35200 |
| Flash Point | 144.3ºC |
| Exact Mass | 262.86300 |
| PSA | 12.89000 |
| LogP | 4.21510 |
| Vapour Pressure | 0.0105mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | BVZNPRRMFJCNKM-UHFFFAOYSA-N |
| SMILES | Clc1cc(Cl)nc(C(Cl)(Cl)Cl)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine,2,4-dichloro-6-(trichloromethyl) |