Methyl 2-(sulfamoylmethyl)benzoate structure
|
Common Name | Methyl 2-(sulfamoylmethyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 112941-26-1 | Molecular Weight | 229.253 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 429.8±55.0 °C at 760 mmHg | |
| Molecular Formula | C9H11NO4S | Melting Point | 100 °C | |
| MSDS | N/A | Flash Point | 213.7±31.5 °C | |
| Name | methyl 2-(sulfamoylmethyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.8±55.0 °C at 760 mmHg |
| Melting Point | 100 °C |
| Molecular Formula | C9H11NO4S |
| Molecular Weight | 229.253 |
| Flash Point | 213.7±31.5 °C |
| Exact Mass | 229.040878 |
| PSA | 94.84000 |
| LogP | 0.47 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | DBOUFTHAEAVMJC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1CS(N)(=O)=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2935009090 |
|
~%
Methyl 2-(sulfa... CAS#:112941-26-1 |
| Literature: Lee, Jae Koo; Ahn, Ki Chang; Park, Oee Sook; Ko, Yong Kwan; Kim, Dae-Whang Journal of agricultural and food chemistry, 2002 , vol. 50, # 7 p. 1791 - 1803 |
|
~%
Methyl 2-(sulfa... CAS#:112941-26-1 |
| Literature: Journal of agricultural and food chemistry, , vol. 50, # 7 p. 1791 - 1803 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Methyl 2-(Aminosulfonylmethyl)benzoate |
| MFCD03265370 |
| methyl 2-[(aminosulfonyl)methyl]benzoate |
| Benzoic acid, 2-[(aminosulfonyl)methyl]-, methyl ester |
| 2-(METHYL FORMATE) BENZYL SULFORNAMIDE |
| EINECS 419-010-5 |
| 2-(Methyl formate)benzyl sulfonamide |
| methyl 2-((sulfamoyl)methyl)benzoate |
| 2-methoxycarbonylbenzylsulfonamide |
| 2-(Aminosulfonylmethyl)benzoic Acid Methyl Ester |
| Methyl 2-(sulfamoylmethyl)benzoate |
| Methyl 2-[(sulphamoyl)methyl]benzoate |
| methyl (aminosulfonyl)-o-toluate |
| o-Carbomethoxybenzyl sulfonamide |
| 2-CARBOMETHOXYBENZYL SULFONAMIDE |
| ZSW1R BVO1 |