(S)-5-(tert-butoxycarbonyl)-5-azaspiro[2.4]heptane-6-carboxylic acid structure
|
Common Name | (S)-5-(tert-butoxycarbonyl)-5-azaspiro[2.4]heptane-6-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1129634-44-1 | Molecular Weight | 241.284 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 377.4±35.0 °C at 760 mmHg | |
| Molecular Formula | C12H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.1±25.9 °C | |
| Name | (S)-5-(tert-butoxycarbonyl)-5-azaspiro[2.4]heptane-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 377.4±35.0 °C at 760 mmHg |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.284 |
| Flash Point | 182.1±25.9 °C |
| Exact Mass | 241.131409 |
| PSA | 66.84000 |
| LogP | 0.94 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.536 |
| InChIKey | VEIYKHIPSJIVRK-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(CC2)CC1C(=O)O |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-Azaspiro[2.4]heptane-5,6-dicarboxylic acid, 5-(1,1-dimethylethyl) ester, (6S)- |
| (6S)-5-[(2-methylpropan-2-yl)oxycarbonyl]-5-azaspiro[2.4]heptane-6-carboxylic acid |
| (6S)-5-{[(2-Methyl-2-propanyl)oxy]carbonyl}-5-azaspiro[2.4]heptane-6-carboxylic acid |