Gramicidin S
Modify Date: 2026-07-16 07:40:00
Gramicidin S structure
|
Common Name | Gramicidin S | ||
|---|---|---|---|---|
| CAS Number | 113-73-5 | Molecular Weight | 1141.447 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 1394.8±65.0 °C at 760 mmHg | |
| Molecular Formula | C60H92N12O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 797.4±34.3 °C | |
Use of Gramicidin SGramicidin S (Gramicidin soviet) is a cationic cyclic peptide antibiotic. Gramicidin S is active against Gram-negative and Gram-positive bacteria by perturbing integrity of the bacterial membranes. Gramicidin S also inhibits cytochrome bd quinol oxidase[1]. |
| Name | gramicidin S |
|---|---|
| Synonym | More Synonyms |
| Description | Gramicidin S (Gramicidin soviet) is a cationic cyclic peptide antibiotic. Gramicidin S is active against Gram-negative and Gram-positive bacteria by perturbing integrity of the bacterial membranes. Gramicidin S also inhibits cytochrome bd quinol oxidase[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 1394.8±65.0 °C at 760 mmHg |
| Molecular Formula | C60H92N12O10 |
| Molecular Weight | 1141.447 |
| Flash Point | 797.4±34.3 °C |
| Exact Mass | 1140.705933 |
| PSA | 353.38000 |
| LogP | 0.10 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | IUAYMJGZBVDSGL-XNNAEKOYSA-N |
| SMILES | CC(C)CC1NC(=O)C(CCCN)NC(=O)C(C(C)C)NC(=O)C2CCCN2C(=O)C(Cc2ccccc2)NC(=O)C(CC(C)C)NC(=O)C(CCCN)NC(=O)C(C(C)C)NC(=O)C2CCCN2C(=O)C(Cc2ccccc2)NC1=O |
| Gramicidin C |
| Cyclo(L-leucyl-D-phenylalanyl-L-prolyl-L-valyl-L-ornithyl-L-leucyl-D-phenylalanyl-L-prolyl-L-valyl-L-ornithyl) |
| Gramacidine S [INN-French] |
| Gramicin S 1 |
| Gramicidinum S [INN-Latin] |
| Gramicidina S [INN-Spanish] |
| gramicidin s |
| Gramicin S-A |