1-(6-bromo-3,4-dihydronaphthalen-2-yl)pyrrolidine structure
|
Common Name | 1-(6-bromo-3,4-dihydronaphthalen-2-yl)pyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 113075-66-4 | Molecular Weight | 278.18800 | |
| Density | 1.41g/cm3 | Boiling Point | 370.7ºC at 760 mmHg | |
| Molecular Formula | C14H16BrN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178ºC | |
| Name | 1-(6-bromo-3,4-dihydronaphthalen-2-yl)pyrrolidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 370.7ºC at 760 mmHg |
| Molecular Formula | C14H16BrN |
| Molecular Weight | 278.18800 |
| Flash Point | 178ºC |
| Exact Mass | 277.04700 |
| PSA | 3.24000 |
| LogP | 3.76990 |
| Vapour Pressure | 1.09E-05mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | OHXASHBAWOZUNU-UHFFFAOYSA-N |
| SMILES | Brc1ccc2c(c1)CCC(N1CCCC1)=C2 |
| HS Code | 2933990090 |
|---|
|
~95%
1-(6-bromo-3,4-... CAS#:113075-66-4 |
| Literature: ELI LILLY AND COMPANY Patent: EP591582 A1, 1994 ; |
|
~%
1-(6-bromo-3,4-... CAS#:113075-66-4 |
| Literature: PFIZER INC.; RUCKER, Paul Vincent Patent: WO2010/13158 A1, 2010 ; Location in patent: Page/Page column 14-15 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Pyrrolidinyl-6-bromo-3,4-dihydronaphthalene |
| S01-0634 |