4-Phenylpyridine 1-oxide structure
|
Common Name | 4-Phenylpyridine 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 1131-61-9 | Molecular Weight | 171.195 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 410.9±24.0 °C at 760 mmHg | |
| Molecular Formula | C11H9NO | Melting Point | 153-155 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 202.3±22.9 °C | |
| Name | 4-Phenylpyridine-N-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 410.9±24.0 °C at 760 mmHg |
| Melting Point | 153-155 °C(lit.) |
| Molecular Formula | C11H9NO |
| Molecular Weight | 171.195 |
| Flash Point | 202.3±22.9 °C |
| Exact Mass | 171.068420 |
| PSA | 25.46000 |
| LogP | 0.93 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | VZOPVKZLLGMDDG-UHFFFAOYSA-N |
| SMILES | [O-][n+]1ccc(-c2ccccc2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933399090 |
|
~93%
4-Phenylpyridin... CAS#:1131-61-9 |
| Literature: Tetrahedron Letters, , vol. 39, # 8 p. 761 - 764 |
|
~64%
4-Phenylpyridin... CAS#:1131-61-9 |
| Literature: Synlett, , # 1 p. 45 - 48 |
|
~70%
4-Phenylpyridin... CAS#:1131-61-9 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 32, # 5 p. 1780 - 1789 |
| Precursor 5 | |
|---|---|
| DownStream 9 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Phenylpyridine-1-oxide |
| EINECS 214-467-5 |
| 1-oxido-4-phenylpyridin-1-ium |
| 4-Phenylpyridine N-Oxide |
| MFCD00006208 |
| Pyridine, 4-phenyl-, 1-oxide |
| 4-Phénylpyridine-1-oxyde |
| 4-Phenylpyridine 1-oxide |