1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid structure
|
Common Name | 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 113100-53-1 | Molecular Weight | 194.111 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 285.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C6H5F3N2O2 | Melting Point | 203ºC | |
| MSDS | Chinese USA | Flash Point | 126.5±27.3 °C | |
| Name | 1-Methyl-3-(Trifluoromethyl)-1H-Pyrazole-4-Carboxylic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 285.6±40.0 °C at 760 mmHg |
| Melting Point | 203ºC |
| Molecular Formula | C6H5F3N2O2 |
| Molecular Weight | 194.111 |
| Flash Point | 126.5±27.3 °C |
| Exact Mass | 194.030319 |
| PSA | 55.12000 |
| LogP | 1.63 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | FZNKJQNEJGXCJH-UHFFFAOYSA-N |
| SMILES | Cn1cc(C(=O)O)c(C(F)(F)F)n1 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933199090 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| T5NNJ A1 CXFFF DVQ |
| 1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid |
| MFCD01936005 |
| 1-Methyl-3-trifluoromethyl-1H-pyrazole-4-carboxylic acid |
| 3-(Trifluoromethyl)-1-methyl-1H-pyrazole-4-carboxylic acid |
| 1-Methyl-3-(trifluoromethyl)pyrazole-4-carboxylic acid |