2-Bromo-6-nitro-4-(trifluoromethyl)aniline structure
|
Common Name | 2-Bromo-6-nitro-4-(trifluoromethyl)aniline | ||
|---|---|---|---|---|
| CAS Number | 113170-71-1 | Molecular Weight | 285.018 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 278.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H4BrF3N2O2 | Melting Point | 71-74 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 122.1±27.3 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-amino-3-bromo-5-nitrobenzotrifluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 278.3±40.0 °C at 760 mmHg |
| Melting Point | 71-74 °C(lit.) |
| Molecular Formula | C7H4BrF3N2O2 |
| Molecular Weight | 285.018 |
| Flash Point | 122.1±27.3 °C |
| Exact Mass | 283.940826 |
| PSA | 71.84000 |
| LogP | 3.70 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | ZUZMWPRSGJTLHW-UHFFFAOYSA-N |
| SMILES | Nc1c(Br)cc(C(F)(F)F)cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S36/37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2921420090 |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00042151 |
| Benzenamine, 2-bromo-6-nitro-4-(trifluoromethyl)- |
| 2-Bromo-6-nitro-4-(trifluoromethyl)aniline |