Methyl 3-bromo-4-(3-methoxy-3-oxopropyl)benzoate structure
|
Common Name | Methyl 3-bromo-4-(3-methoxy-3-oxopropyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 1133314-10-9 | Molecular Weight | 301.13300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 3-bromo-4-(3-methoxy-3-oxopropyl)benzoate |
|---|
| Molecular Formula | C12H13BrO4 |
|---|---|
| Molecular Weight | 301.13300 |
| Exact Mass | 300.00000 |
| PSA | 52.60000 |
| LogP | 2.34130 |
| InChIKey | PXJBDEOGQHZJJU-UHFFFAOYSA-N |
| SMILES | COC(=O)CCc1ccc(C(=O)OC)cc1Br |
| HS Code | 2918990090 |
|---|
|
~52%
Methyl 3-bromo-... CAS#:1133314-10-9 |
| Literature: Pechlivanidis, Zissis; Hopf, Henning; Ernst, Ludger European Journal of Organic Chemistry, 2009 , # 2 p. 223 - 237 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |