N-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]carbamothioyl]benzamide structure
|
Common Name | N-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]carbamothioyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 113333-06-5 | Molecular Weight | 418.33100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H12BrN3OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[[4-(4-bromophenyl)-1,3-thiazol-2-yl]carbamothioyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H12BrN3OS2 |
|---|---|
| Molecular Weight | 418.33100 |
| Exact Mass | 416.96100 |
| PSA | 124.88000 |
| LogP | 5.49470 |
| InChIKey | FLFJKMGGOKMOLM-UHFFFAOYSA-N |
| SMILES | O=C(NC(=S)Nc1nc(-c2ccc(Br)cc2)cs1)c1ccccc1 |
|
~%
N-[[4-(4-bromop... CAS#:113333-06-5 |
| Literature: Dhindsa, G. S. Polish Journal of Chemistry, 1986 , vol. 60, # 4-6 p. 609 - 614 |
|
~%
N-[[4-(4-bromop... CAS#:113333-06-5 |
| Literature: Dhindsa, G. S. Polish Journal of Chemistry, 1986 , vol. 60, # 4-6 p. 609 - 614 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzamide,N-[[[4-(4-bromophenyl)-2-thiazolyl]amino]thioxomethyl] |
| N-(4-p-bromophenyl-2-thiazolyl)-N'-benzylthiourea |