1-(4-Methoxy-2-nitrophenyl)propan-2-one structure
|
Common Name | 1-(4-Methoxy-2-nitrophenyl)propan-2-one | ||
|---|---|---|---|---|
| CAS Number | 113352-66-2 | Molecular Weight | 209.199 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 334.8±27.0 °C at 760 mmHg | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.6±25.7 °C | |
| Name | 1-(4-methoxy-2-nitrophenyl)propan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 334.8±27.0 °C at 760 mmHg |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.199 |
| Flash Point | 152.6±25.7 °C |
| Exact Mass | 209.068802 |
| PSA | 72.12000 |
| LogP | 1.39 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | WHTPGMMGMTXQEC-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC(C)=O)c([N+](=O)[O-])c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-nitro-4-methoxyphenylacetone |
| 1-(4-Methoxy-2-nitrophenyl)acetone |
| 2-Propanone, 1-(4-methoxy-2-nitrophenyl)- |