tert-Butyl (3-(methylamino)phenyl)carbamate structure
|
Common Name | tert-Butyl (3-(methylamino)phenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 1134328-09-8 | Molecular Weight | 222.283 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 302.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.6±23.2 °C | |
| Name | tert-Butyl (3-(methylamino)phenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 302.3±25.0 °C at 760 mmHg |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.283 |
| Flash Point | 136.6±23.2 °C |
| Exact Mass | 222.136826 |
| PSA | 53.85000 |
| LogP | 2.92 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | OYQSQKBDOJILSC-UHFFFAOYSA-N |
| SMILES | CNc1cccc(NC(=O)OC(C)(C)C)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Carbamic acid, N-[3-(methylamino)phenyl]-, 1,1-dimethylethyl ester |
| tert-butyl N-[3-(methylamino)phenyl]carbamate |
| 2-Methyl-2-propanyl [3-(methylamino)phenyl]carbamate |