3,6-dimethoxy-9-(2,4,6-trimethylphenyl)fluoren-9-ol structure
|
Common Name | 3,6-dimethoxy-9-(2,4,6-trimethylphenyl)fluoren-9-ol | ||
|---|---|---|---|---|
| CAS Number | 113533-27-0 | Molecular Weight | 360.44600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,6-dimethoxy-9-(2,4,6-trimethylphenyl)fluoren-9-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H24O3 |
|---|---|
| Molecular Weight | 360.44600 |
| Exact Mass | 360.17300 |
| PSA | 38.69000 |
| LogP | 4.89360 |
| InChIKey | KHVWZNWISSHORS-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)-c1cc(OC)ccc1C2(O)c1c(C)cc(C)cc1C |
|
~86%
3,6-dimethoxy-9... CAS#:113533-27-0 |
| Literature: Bordwell, Frederick G.; Cheng, Jin-Pei; Bausch, Mark J. Journal of the American Chemical Society, 1988 , vol. 110, # 9 p. 2867 - 2872 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9H-Fluoren-9-ol,3,6-dimethoxy-9-(2,4,6-trimethylphenyl) |