2,4,6-trimethylphenylmagnesium bromide structure
|
Common Name | 2,4,6-trimethylphenylmagnesium bromide | ||
|---|---|---|---|---|
| CAS Number | 2633-66-1 | Molecular Weight | 223.39300 | |
| Density | 1.005 g/mL at 25 °C | Boiling Point | N/A | |
| Molecular Formula | C9H11BrMg | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 1 °F | |
| Name | magnesium,1,3,5-trimethylbenzene-6-ide,bromide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.005 g/mL at 25 °C |
|---|---|
| Molecular Formula | C9H11BrMg |
| Molecular Weight | 223.39300 |
| Flash Point | 1 °F |
| Exact Mass | 221.98900 |
| LogP | 3.25760 |
| Appearance of Characters | Solution | Light yellow to brown |
| InChIKey | JOWQNXIISCPKBK-UHFFFAOYSA-M |
| SMILES | Cc1[c-]c(C)cc(C)c1.[Br-].[Mg+2] |
| Water Solubility | It reacts with water. |
| Hazard Codes | F+,C,F |
|---|---|
| Risk Phrases | R12 |
| Safety Phrases | 45-36/37/39-26-16 |
| RIDADR | UN 3399 4.3/PG 1 |
| WGK Germany | 3 |
| Packaging Group | I |
| Hazard Class | 4.2 |
| HS Code | 2931900090 |
|
~%
2,4,6-trimethyl... CAS#:2633-66-1 |
| Literature: Zhao, Fei; Yu, Da-Gang; Zhu, Ru-Yi; Xi, Zhenfeng; Shi, Zhang-Jie Chemistry Letters, 2011 , vol. 40, # 9 p. 1001 - 1003 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1-mesitylMgBr |
| 2,4,6-Trimethylphenylmagnesium bromide |
| 2,4,6-Me3PhMgBr |
| 2-mesitylmagnesium bromide |
| 2-mesityl MgBr |
| 2,4,6-Trimethylphenylmagnesium bromide 0.5 M in Tetrahydrofuran |
| 2,3-DIMETHOXYPYRIDINE-5-BORONIC ACID,PINACOL ESTER |
| mesitylmagnesium bromide |
| MFCD00009663 |
| 2-Mesitylmagnesium bromide solution |