Fmoc-Gln(Dod)-OH structure
|
Common Name | Fmoc-Gln(Dod)-OH | ||
|---|---|---|---|---|
| CAS Number | 113534-17-1 | Molecular Weight | 594.65400 | |
| Density | 1.263g/cm3 | Boiling Point | 872.8ºC at 760 mmHg | |
| Molecular Formula | C35H34N2O7 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 481.7ºC | |
| Name | (2S)-5-[bis(4-methoxyphenyl)methylamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxopentanoic acid |
|---|
| Density | 1.263g/cm3 |
|---|---|
| Boiling Point | 872.8ºC at 760 mmHg |
| Molecular Formula | C35H34N2O7 |
| Molecular Weight | 594.65400 |
| Flash Point | 481.7ºC |
| Exact Mass | 594.23700 |
| PSA | 123.19000 |
| LogP | 6.46330 |
| Vapour Pressure | 1.46E-32mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | LATICJFEOIZOBM-HKBQPEDESA-N |
| SMILES | COc1ccc(C(NC(=O)CCC(NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)O)c2ccc(OC)cc2)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 22-24/25 |
| RIDADR | NONH for all modes of transport |